2-BROMO-1-[3,5-DI(TERT-BUTYL)-4-HYDROXYPHENYL]ETHAN-1-ONE structure
|
Common Name | 2-BROMO-1-[3,5-DI(TERT-BUTYL)-4-HYDROXYPHENYL]ETHAN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 14386-64-2 | Molecular Weight | 327.257 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 347.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C16H23BrO2 | Melting Point | 96ºC | |
| MSDS | N/A | Flash Point | 163.9±26.5 °C | |
| Name | 2-bromo-1-(3,5-ditert-butyl-4-hydroxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 347.4±37.0 °C at 760 mmHg |
| Melting Point | 96ºC |
| Molecular Formula | C16H23BrO2 |
| Molecular Weight | 327.257 |
| Flash Point | 163.9±26.5 °C |
| Exact Mass | 326.088135 |
| PSA | 37.30000 |
| LogP | 5.33 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | UYPXQSLSPUBZQW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(=O)CBr)cc(C(C)(C)C)c1O |
| Hazard Codes | C:Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN1759 |
| Packaging Group | III |
| HS Code | 2914700090 |
|
~74%
2-BROMO-1-[3,5-... CAS#:14386-64-2 |
| Literature: Zhang, Kai; Corrie, John E. T.; Munasinghe, V. Ranjit N.; Wan, Peter Journal of the American Chemical Society, 1999 , vol. 121, # 24 p. 5625 - 5632 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3,5-Di-(tert-butyl)-4-hydroxyphenacyl bromide |
| 2-BROMO-1-[3,5-DI(TERT-BUTYL)-4-HYDROXYPHENYL]ETHAN-1-ONE |
| 4-(2-bromoacetyl)-2,6-di-tert-butylphenol |
| 2-Bromo-1-(3,5-di-tert-butyl-4-hydroxyphenyl)ethanone |
| 1-[3,5-bis-(1,1-dimethylethyl)-4-hydroxyphenyl]-2-bromo-ethanone |
| 2-Bromo-1-[3,5-di-(tert-butyl)-4-hydroxyphenyl]ethan-1-one |
| 1-[3,5-Bis(1,1-dimethylethyl)-4-hydroxyphenyl]-2-bromoethanone |
| 2-Bromo-1-[4-hydroxy-3,5-bis(2-methyl-2-propanyl)phenyl]ethanone |
| 1-[3,5-bis(tert-butyl)-4-hydroxyphenyl]-2-bromoethan-1-one |
| 1-(3,5-di-tert-butyl-4-hydroxyphenyl)-2-bromoethan-1-one |