10-methoxy-7-methyl-6,7,7a,8-tetrahydro-5H-benzo[g][1,3]dioxolo[4',5':4,5]benzo[1,2,3-de]quinoline
Modify Date: 2025-10-19 21:41:01
![10-methoxy-7-methyl-6,7,7a,8-tetrahydro-5H-benzo[g][1,3]dioxolo[4',5':4,5]benzo[1,2,3-de]quinoline Structure](https://image.chemsrc.com/caspic/017/28360-52-3.png)
10-methoxy-7-methyl-6,7,7a,8-tetrahydro-5H-benzo[g][1,3]dioxolo[4',5':4,5]benzo[1,2,3-de]quinoline structure
|
Common Name | 10-methoxy-7-methyl-6,7,7a,8-tetrahydro-5H-benzo[g][1,3]dioxolo[4',5':4,5]benzo[1,2,3-de]quinoline | ||
|---|---|---|---|---|
| CAS Number | 28360-52-3 | Molecular Weight | 309.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-methoxy-7-methyl-6,7,7a,8-tetrahydro-5H-benzo[g][1,3]dioxolo[4',5':4,5]benzo[1,2,3-de]quinoline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H19NO3 |
|---|---|
| Molecular Weight | 309.35900 |
| Exact Mass | 309.13600 |
| PSA | 30.93000 |
| LogP | 3.11390 |
| InChIKey | GXFOBPWUVXXUIF-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)CC1c3c(cc4c(c3-2)OCO4)CCN1C |
|
Name: NOVARTIS: Inhibition of Plasmodium falciparum 3D7 (drug-susceptible) proliferation in...
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL1040691
|
|
Name: NOVARTIS: Inhibition Frequency Index (IFI) - the number of HTS assays where a compoun...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1040694
|
|
Name: NOVARTIS: Inhibition of Plasmodium falciparum W2 (drug-resistant) proliferation in er...
Source: ChEMBL
Target: Plasmodium falciparum
External Id: CHEMBL1040692
|
|
Name: NOVARTIS: Cytotoxicity against human hepatocellular carcinoma cell line (Huh7)
Source: ChEMBL
Target: Huh-7
External Id: CHEMBL1040693
|
Total 5, Current Page 1 of 1
1
| 9-Methoxy-1,2-methylendioxyaporphin (=d,l-Isolaurelin) |
| (+/-)-isolaureline |
| dl-Isolaurelin |
| (+/-)-Isolanrelin |
| (+/-)-Isolaurelin |
| (+/-)-Stepanine |