4-amino-2,3-difluoro-5-nitrobenzoic acid structure
|
Common Name | 4-amino-2,3-difluoro-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 284030-57-5 | Molecular Weight | 218.11400 | |
| Density | 1.751 | Boiling Point | 401.139ºC at 760 mmHg | |
| Molecular Formula | C7H4F2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.402°C | |
| Name | 4-amino-2,3-difluoro-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.751 |
|---|---|
| Boiling Point | 401.139ºC at 760 mmHg |
| Molecular Formula | C7H4F2N2O4 |
| Molecular Weight | 218.11400 |
| Flash Point | 196.402°C |
| Exact Mass | 218.01400 |
| PSA | 109.14000 |
| LogP | 2.25780 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | WXXHOWQPFHXRDY-UHFFFAOYSA-N |
| SMILES | Nc1c([N+](=O)[O-])cc(C(=O)O)c(F)c1F |
| HS Code | 2922499990 |
|---|
|
~93%
4-amino-2,3-dif... CAS#:284030-57-5 |
| Literature: US2004/116710 A1, ; Page 6; 16 ; US 20040116710 A1 |
|
~%
4-amino-2,3-dif... CAS#:284030-57-5 |
| Literature: WO2013/142182 A2, ; |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-AMINO-2,3-DIFLUORO-5-NITRO-BENZOIC ACID |
| 4-amino-2,3-difluoro-5-nitro-benzoic acid 3 |