4-Amino-2-ethoxy-5-nitrobenzoic acid structure
|
Common Name | 4-Amino-2-ethoxy-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 86718-18-5 | Molecular Weight | 226.18600 | |
| Density | 1.444g/cm3 | Boiling Point | 461.8ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.1ºC | |
| Name | 4-Amino-2-ethoxy-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 461.8ºC at 760 mmHg |
| Molecular Formula | C9H10N2O5 |
| Molecular Weight | 226.18600 |
| Flash Point | 233.1ºC |
| Exact Mass | 226.05900 |
| PSA | 118.37000 |
| LogP | 2.37830 |
| Index of Refraction | 1.623 |
| InChIKey | VWEUQGXBVCSDPM-UHFFFAOYSA-N |
| SMILES | CCOc1cc(N)c([N+](=O)[O-])cc1C(=O)O |
| HS Code | 2922509090 |
|---|
|
~%
4-Amino-2-ethox... CAS#:86718-18-5 |
| Literature: Helvetica Chimica Acta, , vol. 32, p. 2331 |
|
~%
4-Amino-2-ethox... CAS#:86718-18-5 |
| Literature: Helvetica Chimica Acta, , vol. 32, p. 2331 |
|
~%
4-Amino-2-ethox... CAS#:86718-18-5 |
| Literature: Helvetica Chimica Acta, , vol. 32, p. 2331 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-amino-2-ethoxy-5-nitrobenzoic acid |