Antitumor agent-100 hydrochloride structure
|
Common Name | Antitumor agent-100 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2841750-53-4 | Molecular Weight | 348.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15Cl2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Antitumor agent-100 hydrochlorideAntitumor agent-100 hydrochloride (compound A6), an apoptosis inducer and molecular glue, shows superior anti-tumor activity[1]. |
| Name | Antitumor agent-100 hydrochloride |
|---|
| Description | Antitumor agent-100 hydrochloride (compound A6), an apoptosis inducer and molecular glue, shows superior anti-tumor activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H15Cl2N3O |
|---|---|
| Molecular Weight | 348.23 |
| InChIKey | LYJYIBIMUKOLLM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccc3c(c2Cl)CN2CC(=O)NC2=N3)cc1.Cl |