3-[(tert-butoxycarbonyl)amino]-3-(3-fluorophenyl)propanoic acid structure
|
Common Name | 3-[(tert-butoxycarbonyl)amino]-3-(3-fluorophenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 284493-59-0 | Molecular Weight | 283.295 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 422.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H18FNO4 | Melting Point | 124-126ºC | |
| MSDS | N/A | Flash Point | 209.1±27.3 °C | |
| Name | 3-(3-fluorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 422.1±40.0 °C at 760 mmHg |
| Melting Point | 124-126ºC |
| Molecular Formula | C14H18FNO4 |
| Molecular Weight | 283.295 |
| Flash Point | 209.1±27.3 °C |
| Exact Mass | 283.121979 |
| PSA | 75.63000 |
| LogP | 2.77 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | IQPQPXUDXQDVMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)c1cccc(F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | S24/25 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(3-Fluorophenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| 3-[(tert-Butoxycarbonyl)amino]-3-(3-fluorophenyl)propanoic acid |
| Benzenepropanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-3-fluoro- |
| Boc-3-Amino-3-(3-fluorophenyl)propionic acid |
| MFCD02090701 |
| 3-n-boc-amino-3-(3-fluorophenyl)propionic acid |