Z-Phe-His-Leu-OH structure
|
Common Name | Z-Phe-His-Leu-OH | ||
|---|---|---|---|---|
| CAS Number | 28458-19-7 | Molecular Weight | 549.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H35N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Z-Phe-His-Leu-OHZ-Phe-His-Leu is the substrate of plasma converting enzyme, with enhanced discriminating power at peak converting enzyme inhibition[1]. |
| Name | Z-L-Phe-L-His-L-Leu-OH |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Phe-His-Leu is the substrate of plasma converting enzyme, with enhanced discriminating power at peak converting enzyme inhibition[1]. |
|---|---|
| Related Catalog | |
| Target |
Plasma converting enzyme[1] |
| References |
| Molecular Formula | C29H35N5O6 |
|---|---|
| Molecular Weight | 549.62 |
| Exact Mass | 549.25900 |
| PSA | 162.51000 |
| LogP | 3.76290 |
| Vapour Pressure | 0mmHg at 25°C |
| InChIKey | BOMYCHBQXOKSLT-SDHOMARFSA-N |
| SMILES | CC(C)CC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)O |
| Z-Phe-His-Leu-OH |