2-[ethyl(3-methylphenyl)amino]ethyl acetate structure
|
Common Name | 2-[ethyl(3-methylphenyl)amino]ethyl acetate | ||
|---|---|---|---|---|
| CAS Number | 28462-19-3 | Molecular Weight | 221.29500 | |
| Density | 1.037 g/cm3 | Boiling Point | 327.3ºC at 760 mmHg | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.6ºC | |
| Name | 2-(N-ethyl-3-methylanilino)ethyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.037 g/cm3 |
|---|---|
| Boiling Point | 327.3ºC at 760 mmHg |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.29500 |
| Flash Point | 118.6ºC |
| Exact Mass | 221.14200 |
| PSA | 29.54000 |
| LogP | 2.38440 |
| Vapour Pressure | 0.000204mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | KMLMCHZWMDCYPI-UHFFFAOYSA-N |
| SMILES | CCN(CCOC(C)=O)c1cccc(C)c1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| n-Ethyl-n-acetoxyethyl-m-toluidine |
| N-acetoxyethyl-N-ethyl-m-toluidine |
| EINECS 249-035-5 |