N-Fmoc-Glycine-2,2-D2 structure
|
Common Name | N-Fmoc-Glycine-2,2-D2 | ||
|---|---|---|---|---|
| CAS Number | 284665-11-8 | Molecular Weight | 299.318 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 545.7±33.0 °C at 760 mmHg | |
| Molecular Formula | C17H13D2NO4 | Melting Point | 174-175ºC(lit.) | |
| MSDS | USA | Flash Point | 283.8±25.4 °C | |
| Name | 2,2-dideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 545.7±33.0 °C at 760 mmHg |
| Melting Point | 174-175ºC(lit.) |
| Molecular Formula | C17H13D2NO4 |
| Molecular Weight | 299.318 |
| Flash Point | 283.8±25.4 °C |
| Exact Mass | 299.112671 |
| PSA | 75.63000 |
| LogP | 3.20 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | NDKDFTQNXLHCGO-KNXIQCGSSA-N |
| SMILES | O=C(O)CNC(=O)OCC1c2ccccc2-c2ccccc21 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
|
~%
N-Fmoc-Glycine-... CAS#:284665-11-8 |
| Literature: Zhang, Xing; Julian, Ryan R. Journal of the American Society for Mass Spectrometry, 2013 , vol. 24, # 4 p. 524 - 533 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Glycine-2,2-d, N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-Gly-OH-2,2-d2 |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl](2,2-H)glycine |
| Glycine-2,2-d2,N-Fmoc |