3-(Diphenylphosphino)propionic acid structure
|
Common Name | 3-(Diphenylphosphino)propionic acid | ||
|---|---|---|---|---|
| CAS Number | 2848-01-3 | Molecular Weight | 258.25200 | |
| Density | 1.290±0.06 g/cm3 | Boiling Point | 89-90 °C(Press: 0.2 Torr) | |
| Molecular Formula | C15H15O2P | Melting Point | 90-94 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-diphenylphosphanylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.290±0.06 g/cm3 |
|---|---|
| Boiling Point | 89-90 °C(Press: 0.2 Torr) |
| Melting Point | 90-94 °C(lit.) |
| Molecular Formula | C15H15O2P |
| Molecular Weight | 258.25200 |
| Exact Mass | 258.08100 |
| PSA | 50.89000 |
| LogP | 2.59400 |
| InChIKey | OTSIFUHGOBFOTH-UHFFFAOYSA-N |
| SMILES | O=C(O)CCP(c1ccccc1)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Safety Phrases | 26-36/37/39-45-39-37-36-A26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (2-Carboxyethyl)diphenylphosphine |
| 3-(diphenylphosphino)propanoic acid |
| (2-Carboxyethyl)diphenylphosphine 4,4-Diphenyl-4-phosphabutanoic acid |
| 3-diphenyl-phosphanyl-propanoic acid |
| 3-(DIPHENYLPHOSPHINO)PROPIONIC ACID |
| 3-diphenylphosphinoyl-propanoic acid |