3-Pentenamide,4-methyl-N-[[[(4-methylphenyl)sulfonyl]amino]carbonyl]- structure
|
Common Name | 3-Pentenamide,4-methyl-N-[[[(4-methylphenyl)sulfonyl]amino]carbonyl]- | ||
|---|---|---|---|---|
| CAS Number | 28490-28-0 | Molecular Weight | 310.36900 | |
| Density | 1.232g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H18N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-N-[(4-methylphenyl)sulfonylcarbamoyl]pent-3-enamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.232g/cm3 |
|---|---|
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.36900 |
| Exact Mass | 310.09900 |
| PSA | 100.72000 |
| LogP | 3.72840 |
| Index of Refraction | 1.546 |
| InChIKey | BILAKQSJCJSCDH-UHFFFAOYSA-N |
| SMILES | CC(C)=CCC(=O)NC(=O)NS(=O)(=O)c1ccc(C)cc1 |
|
~%
3-Pentenamide,4... CAS#:28490-28-0 |
| Literature: Pala,G. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, # 3 p. 556 - 557 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-methyl-N-{[(4-methylphenyl)sulfonyl]carbamoyl}pent-3-enamide |