3-methyl-8-phenyl-7H-purine-2,6-dione
3-methyl-8-phenyl-7H-purine-2,6-dione structure
|
Common Name | 3-methyl-8-phenyl-7H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 2850-34-2 | Molecular Weight | 242.23300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methyl-8-phenyl-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10N4O2 |
|---|---|
| Molecular Weight | 242.23300 |
| Exact Mass | 242.08000 |
| PSA | 83.80000 |
| LogP | 1.02920 |
| InChIKey | WQKYRUYHWSIGAN-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(-c3ccccc3)nc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Binding affinity at Adenosine A2 receptor in rat striatal membrane using [3H]- 5'-N-e...
Source: ChEMBL
Target: Adenosine receptor A2a
External Id: CHEMBL644624
|
|
Name: Binding affinity at Adenosine A1 receptor in rat brain cortical membrane using [3H]N6...
Source: ChEMBL
Target: Adenosine receptor A1
External Id: CHEMBL643484
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-methyl-8-phenylxanthine |
| 1H-Purine-2,6-dione,3,7-dihydro-3-methyl-8-phenyl |
| 3-Methyl-8-phenyl-xanthin |
| 1-Methyl-8-phenylxanthin |
| 3-methyl-8-phenyl-3,7-dihydro-purine-2,6-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-methyl-8-phenyl-7H-purine-2,6-dione? |
| A: Molecular weight of 3-methyl-8-phenyl-7H-purine-2,6-dione is 242.23300. |
| Q: What is the InChIKey of 3-methyl-8-phenyl-7H-purine-2,6-dione? |
| A: InChIKey of 3-methyl-8-phenyl-7H-purine-2,6-dione is WQKYRUYHWSIGAN-UHFFFAOYSA-N. |
| Q: What is the LogP of 3-methyl-8-phenyl-7H-purine-2,6-dione? |
| A: LogP of 3-methyl-8-phenyl-7H-purine-2,6-dione is 1.02920. |
| Q: What is the molecular formula of 3-methyl-8-phenyl-7H-purine-2,6-dione? |
| A: Molecular formula of 3-methyl-8-phenyl-7H-purine-2,6-dione is C12H10N4O2. |
| Q: What is the polar surface area (PSA) of 3-methyl-8-phenyl-7H-purine-2,6-dione? |
| A: Polar surface area (PSA) of 3-methyl-8-phenyl-7H-purine-2,6-dione is 83.80000. |
| Q: What is the English name of 3-methyl-8-phenyl-7H-purine-2,6-dione? |
| A: The English name of 3-methyl-8-phenyl-7H-purine-2,6-dione is 3-methyl-8-phenyl-7H-purine-2,6-dione. |
| Q: What is the SMILES notation of 3-methyl-8-phenyl-7H-purine-2,6-dione? |
| A: SMILES notation of 3-methyl-8-phenyl-7H-purine-2,6-dione is Cn1c(=O)[nH]c(=O)c2[nH]c(-c3ccccc3)nc21. |
| Q: What are the upstream materials of 3-methyl-8-phenyl-7H-purine-2,6-dione? |
| A: Related upstream materials(CAS) of 3-methyl-8-phenyl-7H-purine-2,6-dione: 6972-78-7;3287-99-8;61885-32-3;6972-82-3;100-52-7;2434-53-9. |
| Q: What English synonyms does 3-methyl-8-phenyl-7H-purine-2,6-dione have? |
| A: English synonyms of 3-methyl-8-phenyl-7H-purine-2,6-dione: 3-methyl-8-phenylxanthine, 1H-Purine-2,6-dione,3,7-dihydro-3-methyl-8-phenyl, 3-Methyl-8-phenyl-xanthin, 1-Methyl-8-phenylxanthin, 3-methyl-8-phenyl-3,7-dihydro-purine-2,6-dione. |
| Q: What is the Chinese name of 2850-34-2? |
| A: Chinese name of 2850-34-2 is 2850-34-2. |