TCMDC-123469 structure
|
Common Name | TCMDC-123469 | ||
|---|---|---|---|---|
| CAS Number | 6972-78-7 | Molecular Weight | 170.126 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H6N4O3 | Melting Point | >300ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 6-Amino-1-Methyl-5-Nitrosouracil |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Melting Point | >300ºC(lit.) |
| Molecular Formula | C5H6N4O3 |
| Molecular Weight | 170.126 |
| Exact Mass | 170.043991 |
| PSA | 110.31000 |
| LogP | -1.53 |
| Index of Refraction | 1.742 |
| InChIKey | AHOWVSJPUQTRNN-UHFFFAOYSA-N |
| SMILES | Cn1c(N)c(N=O)c(=O)[nH]c1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
|
~97%
TCMDC-123469 CAS#:6972-78-7 |
| Literature: Balssa, Frederic; Bonnaire, Yves Journal of Labelled Compounds and Radiopharmaceuticals, 2007 , vol. 50, # 1 p. 33 - 41 |
|
~%
TCMDC-123469 CAS#:6972-78-7 |
| Literature: DE227390 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 1177 |
|
~%
TCMDC-123469 CAS#:6972-78-7 |
| Literature: Chemische Berichte, , vol. 33, p. 3047 Chem. Zentralbl., , vol. 72, # I p. 548 |
|
~%
TCMDC-123469 CAS#:6972-78-7 |
| Literature: DE206453 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 9, p. 1005 |
|
~%
TCMDC-123469 CAS#:6972-78-7 |
| Literature: DE227390 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 1177 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-amino-1-methyl-5-nitrosopyrimidine-2,4-dione |
| 2,4(1H,3H)-Pyrimidinedione, 6-amino-1-methyl-5-nitroso- |
| TCMDC-123469 |
| 6-Amino-1-methyl-5-nitrosouracil |
| EINECS 230-213-6 |
| MFCD01104056 |
| 6-Amino-1-methyl-5-nitroso-2,4(1H,3H)-pyrimidinedione |
| 6-amino-1-methyl-5-nitrosopyrimidine-2,4(1H,3H)-dione |