Mtb-IN-2 structure
|
Common Name | Mtb-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 2861190-30-7 | Molecular Weight | 308.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mtb-IN-2Mtb-IN-2 (compound 10c) is an antimicrobial agent against Mycobacterium tuberculosis (Mtb), without cytotoxicity. Mtb-IN-2 significantly decreases colony-forming units (CFU) in spleen of murine tuberculosis models, and distinguishes both drug-sensitive and drug-resistant Mtb H37Rv strains. Mtb-IN-2 affects methionine metabolism but not folate pathway directly. |
| Name | Mtb-IN-2 |
|---|
| Description | Mtb-IN-2 (compound 10c) is an antimicrobial agent against Mycobacterium tuberculosis (Mtb), without cytotoxicity. Mtb-IN-2 significantly decreases colony-forming units (CFU) in spleen of murine tuberculosis models, and distinguishes both drug-sensitive and drug-resistant Mtb H37Rv strains. Mtb-IN-2 affects methionine metabolism but not folate pathway directly. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H12N2O4 |
|---|---|
| Molecular Weight | 308.29 |
| InChIKey | WOVBYNARRLCBNS-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(C(=O)O)c(O)c1)c1ccc2ccccc2n1 |