N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide
N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide structure
|
Common Name | N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 28666-13-9 | Molecular Weight | 292.41600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H28N2O2 |
|---|---|
| Molecular Weight | 292.41600 |
| Exact Mass | 292.21500 |
| PSA | 52.90000 |
| LogP | 3.97050 |
| InChIKey | GHBAGJQMBROMJR-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)N(C(=O)NC1CCCCC1)C1CCCCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~40%
N-cyclohexyl-N-... CAS#:28666-13-9 |
| Literature: Bernasconi, S.; Comini, A.; Corbella, A.; Gariboldi, P.; Sisti, M. Synthesis, 1980 , # 5 p. 385 - 387 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,N'-Dicyclohexyl-N-methacryloyl-harnstoff |
| N-Methylacryloyldicyclohexylharnstoff |
| N-CYCLOHEXYL-N-(CYCLOHEXYLCARBAMOYL)METHACRYLAMIDE |
| N-(2-methylacryloyl)-N,N'-dicyclohexylurea |
| 2-Propenamide,N-cyclohexyl-N-[(cyclohexylamino)carbonyl]-2-methyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 28666-13-9? |
| A: Chinese name of 28666-13-9 is 28666-13-9. |
| Q: What is the molecular weight of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide? |
| A: Molecular weight of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide is 292.41600. |
| Q: What is the LogP of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide? |
| A: LogP of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide is 3.97050. |
| Q: What is the polar surface area (PSA) of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide? |
| A: Polar surface area (PSA) of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide is 52.90000. |
| Q: What is the CAS number of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide? |
| A: CAS number of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide is 28666-13-9. |
| Q: What is the molecular formula of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide? |
| A: Molecular formula of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide is C17H28N2O2. |
| Q: What is the InChIKey of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide? |
| A: InChIKey of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide is GHBAGJQMBROMJR-UHFFFAOYSA-N. |
| Q: What is the English name of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide? |
| A: The English name of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide is N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide. |
| Q: What are the upstream materials of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide? |
| A: Related upstream materials(CAS) of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide: 79-41-4;538-75-0. |
| Q: What English synonyms does N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide have? |
| A: English synonyms of N-cyclohexyl-N-(cyclohexylcarbamoyl)-2-methylprop-2-enamide: N,N'-Dicyclohexyl-N-methacryloyl-harnstoff, N-Methylacryloyldicyclohexylharnstoff, N-CYCLOHEXYL-N-(CYCLOHEXYLCARBAMOYL)METHACRYLAMIDE, N-(2-methylacryloyl)-N,N'-dicyclohexylurea, 2-Propenamide,N-cyclohexyl-N-[(cyclohexylamino)carbonyl]-2-methyl. |