3-[(E)-2-(1-methyl-2H-pyridin-2-yl)ethenyl]phenol structure
|
Common Name | 3-[(E)-2-(1-methyl-2H-pyridin-2-yl)ethenyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 28673-01-0 | Molecular Weight | 339.17200 | |
| Density | 1.18g/cm3 | Boiling Point | 393.4ºC at 760 mmHg | |
| Molecular Formula | C14H14INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.8ºC | |
| Name | 3-[(E)-2-(1-methylpyridin-1-ium-2-yl)ethenyl]phenol,iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 393.4ºC at 760 mmHg |
| Molecular Formula | C14H14INO |
| Molecular Weight | 339.17200 |
| Flash Point | 212.8ºC |
| Exact Mass | 339.01200 |
| PSA | 24.11000 |
| Vapour Pressure | 9.44E-07mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | GMAJSHGCHVHKLV-HRNDJLQDSA-N |
| SMILES | C[n+]1ccccc1C=Cc1cccc(O)c1.[I-] |
|
~%
3-[(E)-2-(1-met... CAS#:28673-01-0 |
| Literature: Phillips Journal of Organic Chemistry, 1947 , vol. 12, p. 333,334 |
|
~%
3-[(E)-2-(1-met... CAS#:28673-01-0 |
| Literature: Saxena et al. Journal of the Chemical Society, 1959 , p. 1579,1585 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3'-Hydroxy-1-methyl-2-stilbazolium-iodid |