Propanoic acid, 2-(4-(1-methylcyclopentyl)-1-cyclohexen-1-yl)- structure
|
Common Name | Propanoic acid, 2-(4-(1-methylcyclopentyl)-1-cyclohexen-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 28673-63-4 | Molecular Weight | 236.35000 | |
| Density | 1.049g/cm3 | Boiling Point | 348.7ºC at 760mmHg | |
| Molecular Formula | C15H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.7ºC | |
| Name | 2-[4-(1-methylcyclopentyl)cyclohexen-1-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.049g/cm3 |
|---|---|
| Boiling Point | 348.7ºC at 760mmHg |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35000 |
| Flash Point | 245.7ºC |
| Exact Mass | 236.17800 |
| PSA | 37.30000 |
| LogP | 4.01390 |
| Vapour Pressure | 8.59E-06mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | KYEAFFQTYWXOME-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)C1=CCC(C2(C)CCCC2)CC1 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Propanoic acid,2-(4-(1-methylcyclopentyl)-1-cyclohexen-1-yl) |