UNII:X92D8F674P structure
|
Common Name | UNII:X92D8F674P | ||
|---|---|---|---|---|
| CAS Number | 28679-16-5 | Molecular Weight | 210.273 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 283.8±23.0 °C at 760 mmHg | |
| Molecular Formula | C11H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.6±28.0 °C | |
| Name | Trimethylhexamethylene Diisocyanate (2,2,4- and 2,4,4- mixture),TMDI |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 283.8±23.0 °C at 760 mmHg |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.273 |
| Flash Point | 114.6±28.0 °C |
| Exact Mass | 210.136826 |
| PSA | 58.86000 |
| LogP | 4.07 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | VZXPHDGHQXLXJC-UHFFFAOYSA-N |
| SMILES | CC(CCCCN=C=O)C(C)(C)N=C=O |
| Hazard Codes | T+ |
|---|---|
| Risk Phrases | 23/24/25-40 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 2206 |
| Hazard Class | 6.1 |
| 1,6-diisocyanatotrimethylhexane |
| Diisocyanatotrimethylhexyl |
| 2,2,4-TRIMETHYL-1,6-DIISOCYANATOHEXANE |
| trimethylhexa-1,6-diyl diisocyanate |
| Hexane, 1,6-diisocyanato-2,2,4-trimethyl- |
| TriMethylhexaMethylene Diisocyanate (2,2,4- and 2,4,4- Mixture) |
| Un2328 |
| 1,6-Diisocyanato-2,2,4-trimethylhexane |
| Einecs 249-151-6 |
| trimethylhexamethyleneisocyanate |
| TMDI |
| Hexane, 1,6-diisocyanato-3,5,5-trimethyl- |
| UNII:X92D8F674P |
| Hexane,1,6-diisocyanatotrimethyl |
| Trimethylhexa-1,6-diyldiisocyanat |