5-nitro-3-carboxybenzisoxazole structure
|
Common Name | 5-nitro-3-carboxybenzisoxazole | ||
|---|---|---|---|---|
| CAS Number | 28691-51-2 | Molecular Weight | 208.12800 | |
| Density | 1.679g/cm3 | Boiling Point | 484.4ºC at 760mmHg | |
| Molecular Formula | C8H4N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.8ºC | |
| Name | 5-nitro-1,2-benzoxazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.679g/cm3 |
|---|---|
| Boiling Point | 484.4ºC at 760mmHg |
| Molecular Formula | C8H4N2O5 |
| Molecular Weight | 208.12800 |
| Flash Point | 246.8ºC |
| Exact Mass | 208.01200 |
| PSA | 109.15000 |
| LogP | 1.95740 |
| Vapour Pressure | 3.4E-10mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | QUPFSFMHDFHTFT-UHFFFAOYSA-N |
| SMILES | O=C(O)c1noc2ccc([N+](=O)[O-])cc12 |
| HS Code | 2934999090 |
|---|
|
~%
5-nitro-3-carbo... CAS#:28691-51-2 |
| Literature: Kemp,D.S.; Paul,K.G. Journal of the American Chemical Society, 1975 , vol. 97, p. 7305 - 7312 |
|
~%
5-nitro-3-carbo... CAS#:28691-51-2 |
| Literature: Kemp,D.S.; Paul,K.G. Journal of the American Chemical Society, 1975 , vol. 97, p. 7305 - 7312 |
|
~%
5-nitro-3-carbo... CAS#:28691-51-2 |
| Literature: Kemp,D.S.; Paul,K.G. Journal of the American Chemical Society, 1975 , vol. 97, p. 7305 - 7312 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-nitro-benzo[d]isoxazole-3-carboxylic acid |
| 3-carboxy-5-nitro-1,2-benzisoxazole |
| 1,2-Benzisoxazole-3-carboxylic acid,5-nitro |
| 5-Nitro-3-carboxybenzisoxazole |
| 5-Nitro-1,2-benzisoxazol-3-carboxylic acid |
| 5-Nitro-3-carboxybenzisoxazol |
| 5-Nitro-1,2-benzisoxazole-3-carboxylicacid |