2-(4-amidinophenyl)-5-benzofurancarboxamidine structure
|
Common Name | 2-(4-amidinophenyl)-5-benzofurancarboxamidine | ||
|---|---|---|---|---|
| CAS Number | 28718-73-2 | Molecular Weight | 314.77000 | |
| Density | 1.4g/cm3 | Boiling Point | 483.6ºC at 760 mmHg | |
| Molecular Formula | C16H15ClN4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.3ºC | |
| Name | 2-(4-carbamimidoylphenyl)-1-benzofuran-5-carboximidamide,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 483.6ºC at 760 mmHg |
| Molecular Formula | C16H15ClN4O |
| Molecular Weight | 314.77000 |
| Flash Point | 246.3ºC |
| Exact Mass | 314.09300 |
| PSA | 112.88000 |
| LogP | 5.07000 |
| Vapour Pressure | 1.65E-09mmHg at 25°C |
| Index of Refraction | 1.712 |
| InChIKey | IOQMTJOUDKMNPJ-UHFFFAOYSA-N |
| SMILES | Cl.Cl.N=C(N)c1ccc(-c2cc3cc(C(=N)N)ccc3o2)cc1 |
| HS Code | 2932999099 |
|---|
|
~%
2-(4-amidinophe... CAS#:28718-73-2 |
| Literature: Bakunov, Stanislav A.; Bakunova, Svetlana M.; Wenzler, Tanja; Barszcz, Todd; Werbovetz, Karl A.; Brun, Reto; Tidwell, Richard R. Journal of Medicinal Chemistry, 2008 , vol. 51, # 21 p. 6927 - 6944 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-amidinophenyl)-5-benzofurancarboxamidine |
| 2-(4-amidinophenyl)-5-amidinobenzofuran dihydrochloride |