2,4,5-Trifluoro-3-methoxybenzoic acid structure
|
Common Name | 2,4,5-Trifluoro-3-methoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 112811-65-1 | Molecular Weight | 206.119 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 284.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H5F3O3 | Melting Point | 105-112 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 125.7±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4,5-Trifluoro-3-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 284.3±35.0 °C at 760 mmHg |
| Melting Point | 105-112 °C(lit.) |
| Molecular Formula | C8H5F3O3 |
| Molecular Weight | 206.119 |
| Flash Point | 125.7±25.9 °C |
| Exact Mass | 206.019073 |
| PSA | 46.53000 |
| LogP | 2.39 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | YVJHZWWMKFQKDC-UHFFFAOYSA-N |
| SMILES | COc1c(F)c(F)cc(C(=O)O)c1F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39-S45-S36 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2918990090 |
|
~86%
2,4,5-Trifluoro... CAS#:112811-65-1 |
| Literature: Asahi Glass Company Ltd. Patent: US5523476 A1, 1996 ; |
|
~%
2,4,5-Trifluoro... CAS#:112811-65-1 |
| Literature: US4997943 A1, ; |
|
~%
2,4,5-Trifluoro... CAS#:112811-65-1 |
| Literature: US4997943 A1, ; |
|
~59%
2,4,5-Trifluoro... CAS#:112811-65-1 |
| Literature: Sanchez, Joseph P.; Gogliotti, Rocco D.; Domagala, John M.; Gracheck, Stephen J.; Huband, Michael D.; et al. Journal of Medicinal Chemistry, 1995 , vol. 38, # 22 p. 4478 - 4487 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Syntheses and crystal structures of di-and triorganotin (IV) derivatives with 2, 4, 5-trifluoro-3-methoxybenzoic acid. Ma CL, et al.
Polyhedron 25(17) , 3405-3412, (2006)
|
|
|
One-pot synthesis and antimicrobial activity of novel quinolone heterocyclic derivatives. Zheng H, et al.
J. Heterocycl. Chem. 47(6) , 1411-1414., (2010)
|
|
|
Crystal structure of triaqua (1, 10-phenanthroline-?2N, N')(2, 4, 5-trifluoro-3-methoxybenzoato-?O1) cobalt (II) 2, 4, 5-trifluoro-3-methoxybenzoate. Sun J.
Acta Crystallogr. Sect. E Struct. Rep. Online 70(11) , m367-m368, (2014)
|
| QVR BF DF EF CO1 |
| 2,4,5-TRIFLUORO-3-METHOXY-BENZOIC ACID |
| 2,4,5-Trifluoro-3-Methoxy |
| MFCD02682012 |
| BENZOIC ACID,2,4,5-TRIFLUORO-3-METHOXY- |
| 3-Methoxyl-2,4,5-TrfluorbenzylAcid |
| 3-Menthoxy-2,4,5-TrifluorobenzoicAcid/2,4,5-Trifluoro-3-MethoxybenzoicAcid |
| 2,4,5-Trifluoro-m-anisic acid |
| 3-METHOXY-2,4,5-TRIFLUOROBENZOICACID |
| 2,4,5-Trifluoro-3-Methoxy Benzoic Acid |
| 3-Methoxy-2,4,5-trifluorobenzoic acid |
| 3-METHOXY-2,4,5-TRIFLUOROBENZOYL CHLORIDE |
| Benzoic acid, 2,4,5-trifluoro-3-methoxy- |
| 3-Methoxy-2,4,5-trifluoroenzoic acid |
| 2,4,5-Trifluoro-3-methoxybenzoic acid |
| 2,4,5-Tetrafluoro-3-methoxybenzoic acid |