a-D-Glucofuranose,1,2-O-(1-methylethylidene)-, cyclic 5,6-carbonothioate3-(4-methylbenzenesulfonate) (9CI) structure
|
Common Name | a-D-Glucofuranose,1,2-O-(1-methylethylidene)-, cyclic 5,6-carbonothioate3-(4-methylbenzenesulfonate) (9CI) | ||
|---|---|---|---|---|
| CAS Number | 2872-64-2 | Molecular Weight | 416.46600 | |
| Density | 1.49g/cm3 | Boiling Point | 521.8ºC at 760mmHg | |
| Molecular Formula | C17H20O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.4ºC | |
| Name | a-D-Glucofuranose,1,2-O-(1-methylethylidene)-, cyclic 5,6-carbonothioate3-(4-methylbenzenesulfonate) (9CI) |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 521.8ºC at 760mmHg |
| Molecular Formula | C17H20O8S2 |
| Molecular Weight | 416.46600 |
| Flash Point | 269.4ºC |
| Exact Mass | 416.06000 |
| PSA | 129.99000 |
| LogP | 2.72640 |
| Vapour Pressure | 1.82E-10mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | UVSKQGNPXXIGDE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC2C(C3COC(=S)O3)OC3OC(C)(C)OC32)cc1 |
|
~73%
a-D-Glucofurano... CAS#:2872-64-2 |
| Literature: Tsuda, Yoshisuke; Sato, Yoshiyuki; Kanemitsu, Kimihiro; Hosoi, Shinzo; Shibayama, Kenji; Nakao, Kayo; Ishikawa, Yuko Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 8 p. 1465 - 1475 |
|
~%
a-D-Glucofurano... CAS#:2872-64-2 |
| Literature: Tsuda, Yoshisuke; Sato, Yoshiyuki; Kanemitsu, Kimihiro; Hosoi, Shinzo; Shibayama, Kenji; Nakao, Kayo; Ishikawa, Yuko Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 8 p. 1465 - 1475 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |