1,2-O-Isopropylidene-a-D-glucofuranose structure
|
Common Name | 1,2-O-Isopropylidene-a-D-glucofuranose | ||
|---|---|---|---|---|
| CAS Number | 18549-40-1 | Molecular Weight | 220.220 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 422.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H16O6 | Melting Point | 159-160 °C(lit.) | |
| MSDS | N/A | Flash Point | 209.3±27.3 °C | |
| Name | 1,2-O-Isopropylidene-D-glucofuranose |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 422.4±40.0 °C at 760 mmHg |
| Melting Point | 159-160 °C(lit.) |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.220 |
| Flash Point | 209.3±27.3 °C |
| Exact Mass | 220.094681 |
| PSA | 88.38000 |
| LogP | -0.17 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | BGGCXQKYCBBHAH-UHFFFAOYSA-N |
| SMILES | CC1(C)OC2OC(C(O)CO)C(O)C2O1 |
| Storage condition | 2~8°C |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| α-D-Glucofuranose, 1,2-O-(1-methylethylidene)- |
| 1,2-O-Isopropylidene-α-D-glucofuranose |
| α-D-Glucofuranose, 1,2-O- (1-methylethylidene)- |
| 1,2-O-Isopropylidene-alpha-D-glucofuranose |
| EINECS 242-420-9 |
| MFCD00063244 |
| Acetone-D-Glucose |
| 1,2-O-Isopropylidene-a-D-glucofuranose |
| Glucofuranose,1,2-O-isopropylidene |
| 1,2-O-Isopropylidene-d-Glucofuranose |
| 1,2-Diisopropylidene-D-glucose |
| 1,2-O-Isopropyliden--D-glucofuranose |
| Monoacetone glucose |