10-Methoxycarbamazepine structure
|
Common Name | 10-Methoxycarbamazepine | ||
|---|---|---|---|---|
| CAS Number | 28721-09-7 | Molecular Weight | 266.29500 | |
| Density | 1.31 | Boiling Point | 468ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O2 | Melting Point | 186-188ºC | |
| MSDS | N/A | Flash Point | 236.8ºC | |
| Name | 10-Methoxycarbamazepine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31 |
|---|---|
| Boiling Point | 468ºC at 760 mmHg |
| Melting Point | 186-188ºC |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.29500 |
| Flash Point | 236.8ºC |
| Exact Mass | 266.10600 |
| PSA | 55.56000 |
| LogP | 4.12660 |
| Vapour Pressure | 6.21E-09mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | PIZOFBKQWNPKDK-UHFFFAOYSA-N |
| SMILES | COC1=Cc2ccccc2N(C(N)=O)c2ccccc21 |
| Storage condition | Refrigerator |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10-Methoxy-5H-dibenz<b,f>azepin-5-carboxamid |
| EINECS 249-189-3 |
| MFCD08460125 |
| 10-methoxy-N-aminocarbonyliminostilbene |
| 10-METHOXY CARBAMAZEPINE |
| Oxcarbazepine Impurity 2 |