Citric acid-C structure
|
Common Name | Citric acid-C | ||
|---|---|---|---|---|
| CAS Number | 287389-42-8 | Molecular Weight | 198.07900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H8O7 | Melting Point | 153-159 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 153-159 °C(lit.) |
|---|---|
| Molecular Formula | C6H8O7 |
| Molecular Weight | 198.07900 |
| Exact Mass | 198.04700 |
| PSA | 132.13000 |
| InChIKey | KRKNYBCHXYNGOX-IDEBNGHGSA-N |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
|
A role for cytosolic isocitrate dehydrogenase as a negative regulator of glucose signaling for insulin secretion in pancreatic ß-cells.
PLoS ONE 8 , e77097, (2013) Cytosolic NADPH may act as one of the signals that couple glucose metabolism to insulin secretion in the pancreatic ß-cell. NADPH levels in the cytoplasm are largely controlled by the cytosolic isofor... |
| Citric acid-13C6 |
| 13C Labeled citric acid |