2-Chloro-1-(2,2,4,7-tetramethyl-2H-quinolin-1-yl)-ethanone structure
|
Common Name | 2-Chloro-1-(2,2,4,7-tetramethyl-2H-quinolin-1-yl)-ethanone | ||
|---|---|---|---|---|
| CAS Number | 28745-09-7 | Molecular Weight | 263.76300 | |
| Density | 1.117g/cm3 | Boiling Point | 431.7ºC at 760mmHg | |
| Molecular Formula | C15H18ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.9ºC | |
| Name | 2-Chloro-1-(2,2,4,7-tetramethyl-2H-quinolin-1-yl)-ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 431.7ºC at 760mmHg |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.76300 |
| Flash Point | 214.9ºC |
| Exact Mass | 263.10800 |
| PSA | 20.31000 |
| LogP | 3.82730 |
| Vapour Pressure | 1.17E-07mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | GQJUBLVBZSKFTN-UHFFFAOYSA-N |
| SMILES | CC1=CC(C)(C)N(C(=O)CCl)c2cc(C)ccc21 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-1-(2,2,4,7-tetramethylquinolin-1-yl)ethanone |