5-(PYRIDIN-3-YL)-1H-PYRAZOLE-3-CARBOXAMIDE structure
|
Common Name | 5-(PYRIDIN-3-YL)-1H-PYRAZOLE-3-CARBOXAMIDE | ||
|---|---|---|---|---|
| CAS Number | 287494-01-3 | Molecular Weight | 188.18600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-pyridin-3-yl-1H-pyrazole-5-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8N4O |
|---|---|
| Molecular Weight | 188.18600 |
| Exact Mass | 188.07000 |
| PSA | 84.66000 |
| LogP | 1.27090 |
| InChIKey | MSLYJWXUPOESJB-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc(-c2cccnc2)n[nH]1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~96%
5-(PYRIDIN-3-YL... CAS#:287494-01-3 |
| Literature: Chang, Kwan Young; Kim, Sung Hoon; Nam, Ghilsoo; Seo, Jae Hong; Kim, Joong Hyup; Ha, Deok-Chan Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 11 p. 1211 - 1214 |
|
~%
5-(PYRIDIN-3-YL... CAS#:287494-01-3 |
| Literature: Chang, Kwan Young; Kim, Sung Hoon; Nam, Ghilsoo; Seo, Jae Hong; Kim, Joong Hyup; Ha, Deok-Chan Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 11 p. 1211 - 1214 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD06166976 |