m-tolualdehyde 2,4-dinitrophenylhydrazone structure
|
Common Name | m-tolualdehyde 2,4-dinitrophenylhydrazone | ||
|---|---|---|---|---|
| CAS Number | 2880-05-9 | Molecular Weight | 300.26900 | |
| Density | 1.36g/cm3 | Boiling Point | 476.2ºC at 760 mmHg | |
| Molecular Formula | C14H12N4O4 | Melting Point | 211-213ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 241.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-[(3-methylphenyl)methylideneamino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 476.2ºC at 760 mmHg |
| Melting Point | 211-213ºC(lit.) |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.26900 |
| Flash Point | 241.8ºC |
| Exact Mass | 300.08600 |
| PSA | 116.03000 |
| LogP | 4.37680 |
| Vapour Pressure | 3.11E-09mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | PQBRXQUGVASQBU-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H335 |
| Precautionary Statements | P261 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,T,F |
| Risk Phrases | 36/37/38-23/24/25-11 |
| Safety Phrases | 26-36-45-27-16 |
| RIDADR | UN 1648 3/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 2928000090 |
|
~%
m-tolualdehyde ... CAS#:2880-05-9 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , p. 1015 - 1020 |
|
~%
m-tolualdehyde ... CAS#:2880-05-9 |
| Literature: Journal of Chemical Research, Miniprint, , # 4 p. 1076 - 1092 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| <3-Methyl-benzaldehyd>-2.4-dinitro-phenylhydrazon |
| m-Tolualdehyde 2,4-Dinitrophenylhydrazone |
| 3'-Methylbenzaldehyde 2,4-Dinitrophenylhydrazone |
| m-Tolualdehyde 2,4-dinitrophenylhydrazone |
| m-Tolualdehyde-DNPH |