13-hydroperoxy-9,11,15-octadecatrienoic acid
Modify Date: 2025-08-25 11:58:40
13-hydroperoxy-9,11,15-octadecatrienoic acid structure
|
Common Name | 13-hydroperoxy-9,11,15-octadecatrienoic acid | ||
|---|---|---|---|---|
| CAS Number | 28836-09-1 | Molecular Weight | 310.42800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (9Z,11E,15Z)-13-hydroperoxy-9,11,15-octadecatrienoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H30O4 |
|---|---|
| Molecular Weight | 310.42800 |
| Exact Mass | 310.21400 |
| PSA | 66.76000 |
| LogP | 5.12860 |
| InChIKey | UYQGVDXDXBAABN-YPPMWDAJSA-N |
| SMILES | CCC=CCC(C=CC=CCCCCCCCC(=O)O)OO |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 13-Hydroperoxy-cis-9-trans-11-cis-15-octadecatriensaeure |
| 13-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid |