2,6-diphenylcyclohexa-2,5-diene-1,4-dione structure
|
Common Name | 2,6-diphenylcyclohexa-2,5-diene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 2887-97-0 | Molecular Weight | 260.28700 | |
| Density | 1.237g/cm3 | Boiling Point | 457.9ºC at 760mmHg | |
| Molecular Formula | C18H12O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.4ºC | |
| Name | 2,6-diphenylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 457.9ºC at 760mmHg |
| Molecular Formula | C18H12O2 |
| Molecular Weight | 260.28700 |
| Flash Point | 170.4ºC |
| Exact Mass | 260.08400 |
| PSA | 34.14000 |
| LogP | 3.30540 |
| Vapour Pressure | 1.43E-08mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | SMDLELADPFDJCZ-UHFFFAOYSA-N |
| SMILES | O=C1C=C(c2ccccc2)C(=O)C(c2ccccc2)=C1 |
| Precursor 10 | |
|---|---|
| DownStream 2 | |
|
Name: Cytotoxicity against human SH-SY5Y cells up to 20 uM for 24 hrs by MTT assay
Source: ChEMBL
Target: SH-SY5Y
External Id: CHEMBL1763697
|
| 2,6-diphenyl-p-benzoquinone |
| 2,6-Diphenylbenzoquinone |
| 2,6-diphenyl-para-benzoquinone |
| 2,5-Cyclohexadiene-1,4-dione,2,6-diphenyl |
| 2,6-diphenyl-1,4-benzoquinone |