Benzyl 3-cyano-1-azetidinecarboxylate structure
|
Common Name | Benzyl 3-cyano-1-azetidinecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 288851-42-3 | Molecular Weight | 216.236 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 391.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3±27.9 °C | |
| Name | benzyl 3-cyanoazetidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 391.0±42.0 °C at 760 mmHg |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.236 |
| Flash Point | 190.3±27.9 °C |
| Exact Mass | 216.089874 |
| PSA | 53.33000 |
| LogP | 0.72 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | OWGOVPJMOBRPON-UHFFFAOYSA-N |
| SMILES | N#CC1CN(C(=O)OCc2ccccc2)C1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzyl 3-cyano-1-azetidinecarboxylate |
| 3-Cyano-1-azetidinecarboxylic acid phenylmethyl ester |
| HT835 |
| 1-Azetidinecarboxylic acid, 3-cyano-, phenylmethyl ester |
| 1-Cbz-3-Cyanoazetidine |
| 3-CYANO-1-CBZ-AZETIDINE |