(2-Amino-5-chlorophenyl)(2,6-difluorophenyl)methanone structure
|
Common Name | (2-Amino-5-chlorophenyl)(2,6-difluorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 28910-83-0 | Molecular Weight | 267.659 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 435.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H8ClF2NO | Melting Point | 151-153ºC | |
| MSDS | N/A | Flash Point | 217.0±28.7 °C | |
| Name | (2-amino-5-chlorophenyl)-(2,6-difluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 435.2±45.0 °C at 760 mmHg |
| Melting Point | 151-153ºC |
| Molecular Formula | C13H8ClF2NO |
| Molecular Weight | 267.659 |
| Flash Point | 217.0±28.7 °C |
| Exact Mass | 267.026245 |
| PSA | 43.09000 |
| LogP | 2.82 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | DUMGVPIXKALANS-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)cc1C(=O)c1c(F)cccc1F |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922399090 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (2-amino-5-chlorophenyl)(2,6-difluorophenyl)methanone |
| 2-Amino-5-chloro-2',6'-difluorobenzophenon |
| Methanone, (2-amino-5-chlorophenyl)(2,6-difluorophenyl)- |
| 2-amino-5-chloro-2',6'-difluorobenzophenone |
| 2-Amino-5-chlor-2',6'-difluorbenzophenon |
| PC6424 |