2-(2-Acethydrazide)-7-chloro-5-phenyl-2H-1,4-dibenzodiazopine-2-one structure
|
Common Name | 2-(2-Acethydrazide)-7-chloro-5-phenyl-2H-1,4-dibenzodiazopine-2-one | ||
|---|---|---|---|---|
| CAS Number | 28910-89-6 | Molecular Weight | 326.78000 | |
| Density | 1.33g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H15ClN4O | Melting Point | 245-247ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(7-chloro-5-phenyl-3H-1,4-benzodiazepin-2-yl)acetohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Melting Point | 245-247ºC |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.78000 |
| Exact Mass | 326.09300 |
| PSA | 79.84000 |
| LogP | 2.60590 |
| Index of Refraction | 1.661 |
| InChIKey | RIYMFZCORTVORQ-UHFFFAOYSA-N |
| SMILES | CC(=O)NNC1=Nc2ccc(Cl)cc2C(c2ccccc2)=NC1 |
| RIDADR | NONH for all modes of transport |
|---|
|
~%
2-(2-Acethydraz... CAS#:28910-89-6 |
| Literature: Takeda Chemical Industries, Ltd. Patent: US4116956 A1, 1978 ; |
|
~%
2-(2-Acethydraz... CAS#:28910-89-6 |
| Literature: The Upjohn Company Patent: US3987052 A1, 1976 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Acetic acid [7-chloro-5-phenyl-1,3 |
| ylidene]-hydrazide |
| Essigsaeure-2-(7-Chlor-5-phenyl-3H-1,4-benzodiazepin-2-yl)hydrazid |
| 7-Chloro-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepine-2 acetylhydrazone |
| 2-(2-acetylhydrazino)-7-chloro-5-phenyl-3H-1,4-benzodiazepine |
| dihydro-benzo[e][1,4]diazepin-(2E) |
| Alprazolam Related Compound A |
| 7-chloro-5-phenyl-1,3-dihydro-benzo[e][1,4]diazepin-2-one acetylhydrazone |