7-Chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepine-2-thione structure
|
Common Name | 7-Chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepine-2-thione | ||
|---|---|---|---|---|
| CAS Number | 4547-02-8 | Molecular Weight | 286.77900 | |
| Density | 1.32 g/cm3 | Boiling Point | 408.9ºC at 760 mmHg | |
| Molecular Formula | C15H11ClN2S | Melting Point | 248-250ºC | |
| MSDS | N/A | Flash Point | 201.1°C | |
| Name | 7-Chloro-5-phenyl-1H-benzo[e]-[1,4]diazepine-2(3H)-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32 g/cm3 |
|---|---|
| Boiling Point | 408.9ºC at 760 mmHg |
| Melting Point | 248-250ºC |
| Molecular Formula | C15H11ClN2S |
| Molecular Weight | 286.77900 |
| Flash Point | 201.1°C |
| Exact Mass | 286.03300 |
| PSA | 56.48000 |
| LogP | 3.50390 |
| Index of Refraction | 1.684 |
| InChIKey | ULILTJWAJZIROM-UHFFFAOYSA-N |
| SMILES | S=C1CN=C(c2ccccc2)c2cc(Cl)ccc2N1 |
| HS Code | 2933990090 |
|---|
|
~85%
7-Chloro-1,3-di... CAS#:4547-02-8 |
| Literature: Goel, O. P.; Krolls, U. Synthesis, 1987 , # 2 p. 162 - 164 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepine-2-thione |
| 7-Chloro-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepin-2-thione |
| BENZP-DINITRIDE-THIO-KETONE |
| 7-chloro-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-thione |
| 7-Chlor-1,3-dihydro-5-phenyl-2H-1,4-benzodiazepin-2-thion |
| 1,3-dihydro-5-phenyl-7-chloro-2H-1,4-benzodiazepine-2-thione |
| Benzodiazepines Intermediate 1 |