3',5'-Dibenzyloxyacetophenone structure
|
Common Name | 3',5'-Dibenzyloxyacetophenone | ||
|---|---|---|---|---|
| CAS Number | 28924-21-2 | Molecular Weight | 332.39200 | |
| Density | 1.144 g/cm3 | Boiling Point | 489.5ºC at 760 mmHg | |
| Molecular Formula | C22H20O3 | Melting Point | 60-64 ºC | |
| MSDS | Chinese USA | Flash Point | 242.1ºC | |
| Name | 1-[3,5-bis(phenylmethoxy)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.144 g/cm3 |
|---|---|
| Boiling Point | 489.5ºC at 760 mmHg |
| Melting Point | 60-64 ºC |
| Molecular Formula | C22H20O3 |
| Molecular Weight | 332.39200 |
| Flash Point | 242.1ºC |
| Exact Mass | 332.14100 |
| PSA | 35.53000 |
| LogP | 5.04720 |
| Vapour Pressure | 9.94E-10mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | KOJXGMJOTRYLBD-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
| Storage condition | -20°C Freezer |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914509090 |
|
~98%
3',5'-Dibenzylo... CAS#:28924-21-2 |
| Literature: Baumann, Thomas; Vogt, Henning; Braese, Stefan European Journal of Organic Chemistry, 2007 , # 2 p. 266 - 282 |
|
~87%
3',5'-Dibenzylo... CAS#:28924-21-2 |
| Literature: Gundu Rao, C.; Radhakrishna, Arakali S.; Bali Singh, Bajrang; Bhatnagar, Surendra P. Synthesis, 1983 , # 10 p. 808 |
|
~70%
3',5'-Dibenzylo... CAS#:28924-21-2 |
| Literature: Vu, Binh; Mezey-Vandor, Gabriella; Nogradi, Mihaly Liebigs Annalen der Chemie, 1984 , # 4 p. 734 - 741 |
|
~%
3',5'-Dibenzylo... CAS#:28924-21-2 |
| Literature: Vu, Binh; Mezey-Vandor, Gabriella; Nogradi, Mihaly Liebigs Annalen der Chemie, 1984 , # 4 p. 734 - 741 |
|
~%
3',5'-Dibenzylo... CAS#:28924-21-2 |
| Literature: Korec, Rudolf; Sensch, Karl Heinz; Zoukas, Thomas Arzneimittel-Forschung/Drug Research, 2000 , vol. 50, # 2 p. 122 - 128 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,5-Dibenzyloxyacetophenone |
| EINECS 249-315-7 |
| 2',5'-dibenzyloxyacetophenone |
| 1-(3,5-Bis(benzyloxy)phenyl)ethanone |
| 3',5'-Dibenzyloxyacetophenone |
| MFCD00004777 |
| 3,5-dibenzyloxy-acetophenone |
| 3',5'-Bis(benzyloxy)acetophenone |
| 5-acetyl-1,3-phenylene dibenzoate |
| Terbutaline Impurity 5 |