CHD-5 structure
|
Common Name | CHD-5 | ||
|---|---|---|---|---|
| CAS Number | 289494-16-2 | Molecular Weight | 319.357 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 426.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H17N3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 212.0±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of CHD-5CHD-5 is a potent AhR (aryl hydrocarbon receptor) antagonist[1]. |
| Name | N-{2-Methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl}-2-furamide |
|---|---|
| Synonym | More Synonyms |
| Description | CHD-5 is a potent AhR (aryl hydrocarbon receptor) antagonist[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 426.9±45.0 °C at 760 mmHg |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.357 |
| Flash Point | 212.0±28.7 °C |
| Exact Mass | 319.132080 |
| LogP | 5.49 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | RDQWQMVBBQKHGH-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1N=Nc1ccc(NC(=O)c2ccco2)c(C)c1 |
| MFCD00389735 |
| 2-Furancarboxamide, N-[2-methyl-4-[(E)-2-(2-methylphenyl)diazenyl]phenyl]- |
| N-{2-Methyl-4-[(E)-(2-methylphenyl)diazenyl]phenyl}-2-furamide |