7,9-dichloro-6-methyl-3,4-dihydro-2H-1,5-benzoxazocin-3-ol structure
|
Common Name | 7,9-dichloro-6-methyl-3,4-dihydro-2H-1,5-benzoxazocin-3-ol | ||
|---|---|---|---|---|
| CAS Number | 28980-11-2 | Molecular Weight | 260.11700 | |
| Density | 1.45g/cm3 | Boiling Point | 384.3ºC at 760mmHg | |
| Molecular Formula | C11H11Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.2ºC | |
| Name | 7,9-dichloro-6-methyl-3,4-dihydro-2H-1,5-benzoxazocin-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 384.3ºC at 760mmHg |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.11700 |
| Flash Point | 186.2ºC |
| Exact Mass | 259.01700 |
| PSA | 41.82000 |
| LogP | 1.99130 |
| Vapour Pressure | 1.36E-06mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | NDWPSXOQOUCYBV-UHFFFAOYSA-N |
| SMILES | CC1=NCC(O)COc2cc(Cl)cc(Cl)c21 |
|
~%
7,9-dichloro-6-... CAS#:28980-11-2 |
| Literature: Basil,B. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 403 - 406 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7,9-Dichloro-3,4-dihydro-6-methyl-2H-1,4-benzoxazocin-3-ol |
| 2H-1,5-Benzoxazocin-3-ol,3,4-dihydro-7,9-dichloro-6-methyl |