Diethyl-(3,4-dimethylbenzyl)malonat
Modify Date: 2025-10-13 10:31:36
Diethyl-(3,4-dimethylbenzyl)malonat structure
|
Common Name | Diethyl-(3,4-dimethylbenzyl)malonat | ||
|---|---|---|---|---|
| CAS Number | 289902-87-0 | Molecular Weight | 278.34300 | |
| Density | 1.065g/cm3 | Boiling Point | 363.4ºC at 760 mmHg | |
| Molecular Formula | C16H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.3ºC | |
| Name | diethyl 2-[(3,4-dimethylphenyl)methyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 363.4ºC at 760 mmHg |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.34300 |
| Flash Point | 173.3ºC |
| Exact Mass | 278.15200 |
| PSA | 52.60000 |
| LogP | 2.58830 |
| Vapour Pressure | 1.8E-05mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | LYGVZJCEQZMAOO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(C)c(C)c1)C(=O)OCC |
| HS Code | 2917399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:289902-88-1| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| I01-9383 |
| diethyl 3,4-dimethylbenzylmalonate |
| Diethyl (3,4-dimethylbenzyl)malonate |
| Diethyl-(3,4-dimethylbenzyl)malonat |
| Propanedioic acid, 2-[(3,4-dimethylphenyl)methyl]-, diethyl ester |
| MFCD09955192 |
| diethyl 2-(3,4-dimethylbenzyl)malonate |