diethyl 3,4-dimethoxybenzene-1,2-dicarboxylate structure
|
Common Name | diethyl 3,4-dimethoxybenzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 100973-01-1 | Molecular Weight | 282.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 3,4-dimethoxybenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O6 |
|---|---|
| Molecular Weight | 282.28900 |
| Exact Mass | 282.11000 |
| PSA | 71.06000 |
| LogP | 2.05720 |
| InChIKey | QBWSSAAQKRJRDZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(OC)c(OC)c1C(=O)OCC |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Diethyl 3,4-dimethoxyphthalate |