7-Nitro-8-quinolyl=3,4-dichlorobenzoate structure
|
Common Name | 7-Nitro-8-quinolyl=3,4-dichlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 29007-10-1 | Molecular Weight | 363.15200 | |
| Density | 1.539g/cm3 | Boiling Point | 596.3ºC at 760 mmHg | |
| Molecular Formula | C16H8Cl2N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.4ºC | |
| Name | (7-nitroquinolin-8-yl) 3,4-dichlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.539g/cm3 |
|---|---|
| Boiling Point | 596.3ºC at 760 mmHg |
| Molecular Formula | C16H8Cl2N2O4 |
| Molecular Weight | 363.15200 |
| Flash Point | 314.4ºC |
| Exact Mass | 361.98600 |
| PSA | 85.01000 |
| LogP | 5.19220 |
| Vapour Pressure | 3.48E-14mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | ZPNNZZWCJPKFNY-UHFFFAOYSA-N |
| SMILES | O=C(Oc1c([N+](=O)[O-])ccc2cccnc12)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,4-Dichlorobenzoic acid 7-nitro-8-quinolyl ester |
| BENZOIC ACID,3,4-DICHLORO-,7-NITRO-8-QUINOLYL ESTER |
| 8-Quinolinol,7-nitro-,3,4-dichlorobenzoate |