2(5H)-Furanone,5-hydroxy-5-(trichloromethyl)- structure
|
Common Name | 2(5H)-Furanone,5-hydroxy-5-(trichloromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 2902-72-9 | Molecular Weight | 217.43500 | |
| Density | 1.876g/cm3 | Boiling Point | 397.8ºC at 760 mmHg | |
| Molecular Formula | C5H3Cl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.4ºC | |
| Name | 5-hydroxy-5-(trichloromethyl)furan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.876g/cm3 |
|---|---|
| Boiling Point | 397.8ºC at 760 mmHg |
| Molecular Formula | C5H3Cl3O3 |
| Molecular Weight | 217.43500 |
| Flash Point | 194.4ºC |
| Exact Mass | 215.91500 |
| PSA | 46.53000 |
| LogP | 1.15820 |
| Vapour Pressure | 5.57E-08mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | VLURPSDJKURISB-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(O)(C(Cl)(Cl)Cl)O1 |
|
~%
2(5H)-Furanone,... CAS#:2902-72-9 |
| Literature: Winston,A. et al. Journal of Organic Chemistry, 1967 , vol. 32, p. 2166 - 2171 |
|
~4%
2(5H)-Furanone,... CAS#:2902-72-9 |
| Literature: Franzen, Robert; Kronberg, Leif Tetrahedron, 1993 , vol. 49, # 47 p. 10945 - 10958 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| VLURPSDJKURISB-UHFFFAOYSA |
| 2-Hydroxy-5-oxo-2-trichloracetyl-2.5-dihydrofueran |
| 5-Hydroxy-5-trichloromethyl-2-furanone |
| 2-Hydroxy-5-oxo-2-trichloracetyl-2.5-dihydrofuran |