2,4,5-Trichlorophenylacetic acid structure
|
Common Name | 2,4,5-Trichlorophenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 2903-64-2 | Molecular Weight | 239.48300 | |
| Density | 1.568g/cm3 | Boiling Point | 353.5ºC at 760 mmHg | |
| Molecular Formula | C8H5Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.6ºC | |
| Name | 2-(2,4,5-trichlorophenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.568g/cm3 |
|---|---|
| Boiling Point | 353.5ºC at 760 mmHg |
| Molecular Formula | C8H5Cl3O2 |
| Molecular Weight | 239.48300 |
| Flash Point | 167.6ºC |
| Exact Mass | 237.93600 |
| PSA | 37.30000 |
| LogP | 3.27390 |
| Vapour Pressure | 1.32E-05mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | CVJKKZSUHFEQTR-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cc(Cl)c(Cl)cc1Cl |
| HS Code | 2916399090 |
|---|
|
~%
2,4,5-Trichloro... CAS#:2903-64-2 |
| Literature: Taylor, David C.; Wightman, Frank; Kazakoff, Clem W. Phytochemistry (Elsevier), 1988 , vol. 27, # l p. 51 - 72 |
|
~%
2,4,5-Trichloro... CAS#:2903-64-2 |
| Literature: Taylor, David C.; Wightman, Frank; Kazakoff, Clem W. Phytochemistry (Elsevier), 1988 , vol. 27, # l p. 51 - 72 |
|
~%
2,4,5-Trichloro... CAS#:2903-64-2 |
| Literature: Taylor, David C.; Wightman, Frank; Kazakoff, Clem W. Phytochemistry (Elsevier), 1988 , vol. 27, # l p. 51 - 72 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4,5-Trichloro-phenylacetic acid |
| 2,4,5-Trichlorobenzeneacetic acid |
| Caswell No. 882D |
| Benzeneacetic acid,2,4,5-trichloro |