Bis(2-carboxyethyl)isocyanurate structure
|
Common Name | Bis(2-carboxyethyl)isocyanurate | ||
|---|---|---|---|---|
| CAS Number | 2904-40-7 | Molecular Weight | 273.20000 | |
| Density | 1.592 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11N3O7 | Melting Point | 289ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[3-(2-carboxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.592 g/cm3 |
|---|---|
| Melting Point | 289ºC |
| Molecular Formula | C9H11N3O7 |
| Molecular Weight | 273.20000 |
| Exact Mass | 273.06000 |
| PSA | 151.96000 |
| Index of Refraction | 1.563 |
| InChIKey | JCUMQTAAEUDUPK-UHFFFAOYSA-N |
| SMILES | O=C(O)CCn1c(=O)[nH]c(=O)n(CCC(=O)O)c1=O |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,3-di(2'-carboxyethyl)-(1H,3H,5H)-1,3,5-triazine-2,4,6-trione |
| 3,3'-(2,4,6-trioxo-[1,3,5]triazinane-1,3-diyl)-bis-propionic acid |
| Isocyanuric Acid Bis(2-carboxyethyl) Ester |
| Di-(2-carboxy-aethyl)-isocyanurat |
| bis(2-carboxyethyl)isocyanurate |
| 1,3-Bis-(2-carboxy-ethyl)-2,4,6-trioxo-hexahydro-s-triazin |
| 3,3'-(2,4,6-trioxo-1,3,5-triazinane-1,3-diyl)dipropanoic acid |
| BIS(2-CARBOXYETHYL) ISOCYANURATE |