Avosentan structure
|
Common Name | Avosentan | ||
|---|---|---|---|---|
| CAS Number | 290815-26-8 | Molecular Weight | 479.508 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 575.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C23H21N5O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.8±32.9 °C | |
Use of AvosentanAvosentan(Ro 67-0565; SPP-301) is a potent, selective endothelin receptor(ETA receptor) antagonist.IC50 value:Target: ETA receptor |
| Name | N-[6-methoxy-5-(2-methoxyphenoxy)-2-pyridin-4-ylpyrimidin-4-yl]-5-methylpyridine-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Avosentan(Ro 67-0565; SPP-301) is a potent, selective endothelin receptor(ETA receptor) antagonist.IC50 value:Target: ETA receptor |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 575.5±60.0 °C at 760 mmHg |
| Molecular Formula | C23H21N5O5S |
| Molecular Weight | 479.508 |
| Flash Point | 301.8±32.9 °C |
| Exact Mass | 479.126343 |
| PSA | 133.80000 |
| LogP | 0.87 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | YBWLTKFZAOSWSM-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccncc2)nc1OC |
| Storage condition | 2-8℃ |
|
~%
Avosentan CAS#:290815-26-8 |
| Literature: Hoffmann-La Roche Inc. Patent: US6417360 B1, 2002 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Avosentan |
| UNII-L94KSX715K |
| 2-Pyridinesulfonamide, N-[6-methoxy-5-(2-methoxyphenoxy)-2-(4-pyridinyl)-4-pyrimidinyl]-5-methyl- |
| N-[6-Methoxy-5-(2-methoxyphenoxy)-2-(4-pyridinyl)-4-pyrimidinyl]-5-methyl-2-pyridinesulfonamide |
| Ro 67-0565 |
| SPP301 |