bis(2-ethylhexyl) succinate structure
|
Common Name | bis(2-ethylhexyl) succinate | ||
|---|---|---|---|---|
| CAS Number | 2915-57-3 | Molecular Weight | 342.51300 | |
| Density | 0.934 g/cm3 | Boiling Point | 358.9ºC at 760 mmHg | |
| Molecular Formula | C20H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158ºC | |
| Name | bis(2-ethylhexyl) butanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.934 g/cm3 |
|---|---|
| Boiling Point | 358.9ºC at 760 mmHg |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.51300 |
| Flash Point | 158ºC |
| Exact Mass | 342.27700 |
| PSA | 52.60000 |
| LogP | 5.28580 |
| Vapour Pressure | 2.46E-05mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | WMNULTDOANGXRT-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)CCC(=O)OCC(CC)CCCC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917190090 |
|
~99%
bis(2-ethylhexy... CAS#:2915-57-3 |
| Literature: Kyowa Yuka Co., Ltd. Patent: EP1426041 A1, 2004 ; Location in patent: Page/Page column 9 ; |
|
~%
bis(2-ethylhexy... CAS#:2915-57-3 |
| Literature: Kumar, S. K. Karthick; Tamimi; Fayer, Michael D. Journal of the American Chemical Society, 2013 , vol. 135, # 13 p. 5118 - 5126 |
|
~%
bis(2-ethylhexy... CAS#:2915-57-3 |
| Literature: Courtaulds Ltd. Patent: US2448448 , 1942 ; |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Wickenol 159 |
| succinic acid bis-(2-ethyl-hexyl ester) |
| Bernsteinsaeure-bis-(2-aethyl-hexylester) |
| Di-2-ethylhexyl succinate |
| Di(2-ethylhexyl)butanedioate |
| Butanedioic acid,bis(2-ethylhexyl) ester |
| Bis(2-ethylhexyl) succinate |
| 2-ethyl-hexyl succinate |