Barium 2-ethylhexoxide (~1M in hexane/toluene) structure
|
Common Name | Barium 2-ethylhexoxide (~1M in hexane/toluene) | ||
|---|---|---|---|---|
| CAS Number | 29170-99-8 | Molecular Weight | 395.76700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H34BaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -23ºC | |
| Name | Barium 2-ethylhexoxide (~1M in hexane/toluene) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H34BaO2 |
|---|---|
| Molecular Weight | 395.76700 |
| Flash Point | -23ºC |
| Exact Mass | 396.16100 |
| PSA | 18.46000 |
| LogP | 5.36740 |
| InChIKey | DXVDYXIHQRRWSS-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C[O-].CCCCC(CC)C[O-].[Ba+2] |
| Risk Phrases | 11-38-48/20 |
|---|---|
| Safety Phrases | 9-16-29-33 |
| RIDADR | UN 1992 |
| HS Code | 2915900090 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Barium 2-Ethylexoxide,1M in Hexane/Toluene |
| BARIUM 2-ETHYLHEXOXIDE |