1,2,3,4,5-pentachloro-6-isocyanatobenzene
Modify Date: 2025-10-10 18:26:09
1,2,3,4,5-pentachloro-6-isocyanatobenzene structure
|
Common Name | 1,2,3,4,5-pentachloro-6-isocyanatobenzene | ||
|---|---|---|---|---|
| CAS Number | 29173-60-2 | Molecular Weight | 291.34600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7Cl5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,3,4,5-pentachloro-6-isocyanatobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7Cl5NO |
|---|---|
| Molecular Weight | 291.34600 |
| Exact Mass | 288.84200 |
| PSA | 29.43000 |
| LogP | 4.92090 |
| InChIKey | XYUCULXRVSQDCG-UHFFFAOYSA-N |
| SMILES | O=C=Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
|
~%
1,2,3,4,5-penta... CAS#:29173-60-2 |
| Literature: Eli Lilly and Company Patent: US3990879 A1, 1976 ; |
|
~%
1,2,3,4,5-penta... CAS#:29173-60-2 |
| Literature: The United States of America as represented by the Secretary of Agriculture Patent: US4477389 A1, 1984 ; |
|
~%
1,2,3,4,5-penta... CAS#:29173-60-2 |
| Literature: Matsumoto, Yotaro; Noguchi-Yachide, Tomomi; Nakamura, Masaharu; Mita, Yusuke; Numadate, Akiyoshi; Hashimoto, Yuichi Heterocycles, 2012 , vol. 86, # 2 p. 1449 - 1463 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| Pentachlorphenylisocyanat |
| Benzene,pentachloroisocyanato |
| pentachlorophenyl isocyanate |