1,2,3,4,5-pentachloro-6-isocyanatobenzene
1,2,3,4,5-pentachloro-6-isocyanatobenzene structure
|
Common Name | 1,2,3,4,5-pentachloro-6-isocyanatobenzene | ||
|---|---|---|---|---|
| CAS Number | 29173-60-2 | Molecular Weight | 291.34600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7Cl5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3,4,5-pentachloro-6-isocyanatobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7Cl5NO |
|---|---|
| Molecular Weight | 291.34600 |
| Exact Mass | 288.84200 |
| PSA | 29.43000 |
| LogP | 4.92090 |
| InChIKey | XYUCULXRVSQDCG-UHFFFAOYSA-N |
| SMILES | O=C=Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,2,3,4,5-penta... CAS#:29173-60-2 |
| Literature: Eli Lilly and Company Patent: US3990879 A1, 1976 ; |
|
~%
1,2,3,4,5-penta... CAS#:29173-60-2 |
| Literature: The United States of America as represented by the Secretary of Agriculture Patent: US4477389 A1, 1984 ; |
|
~%
1,2,3,4,5-penta... CAS#:29173-60-2 |
| Literature: Matsumoto, Yotaro; Noguchi-Yachide, Tomomi; Nakamura, Masaharu; Mita, Yusuke; Numadate, Akiyoshi; Hashimoto, Yuichi Heterocycles, 2012 , vol. 86, # 2 p. 1449 - 1463 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pentachlorphenylisocyanat |
| Benzene,pentachloroisocyanato |
| pentachlorophenyl isocyanate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 29173-60-2? |
| A: Chinese name of 29173-60-2 is 29173-60-2. |
| Q: What is the LogP of 1,2,3,4,5-pentachloro-6-isocyanatobenzene? |
| A: LogP of 1,2,3,4,5-pentachloro-6-isocyanatobenzene is 4.92090. |
| Q: What is the molecular weight of 1,2,3,4,5-pentachloro-6-isocyanatobenzene? |
| A: Molecular weight of 1,2,3,4,5-pentachloro-6-isocyanatobenzene is 291.34600. |
| Q: What is the CAS number of 1,2,3,4,5-pentachloro-6-isocyanatobenzene? |
| A: CAS number of 1,2,3,4,5-pentachloro-6-isocyanatobenzene is 29173-60-2. |
| Q: What is the InChIKey of 1,2,3,4,5-pentachloro-6-isocyanatobenzene? |
| A: InChIKey of 1,2,3,4,5-pentachloro-6-isocyanatobenzene is XYUCULXRVSQDCG-UHFFFAOYSA-N. |
| Q: What English synonyms does 1,2,3,4,5-pentachloro-6-isocyanatobenzene have? |
| A: English synonyms of 1,2,3,4,5-pentachloro-6-isocyanatobenzene: Pentachlorphenylisocyanat, Benzene,pentachloroisocyanato, pentachlorophenyl isocyanate. |
| Q: What is the polar surface area (PSA) of 1,2,3,4,5-pentachloro-6-isocyanatobenzene? |
| A: Polar surface area (PSA) of 1,2,3,4,5-pentachloro-6-isocyanatobenzene is 29.43000. |
| Q: What is the SMILES notation of 1,2,3,4,5-pentachloro-6-isocyanatobenzene? |
| A: SMILES notation of 1,2,3,4,5-pentachloro-6-isocyanatobenzene is O=C=Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl. |
| Q: What is the molecular formula of 1,2,3,4,5-pentachloro-6-isocyanatobenzene? |
| A: Molecular formula of 1,2,3,4,5-pentachloro-6-isocyanatobenzene is C7Cl5NO. |
| Q: What are the upstream materials of 1,2,3,4,5-pentachloro-6-isocyanatobenzene? |
| A: Related upstream materials(CAS) of 1,2,3,4,5-pentachloro-6-isocyanatobenzene: 75-44-5;527-20-8;632-22-4;32315-10-9. |