Pentachloroaniline structure
|
Common Name | Pentachloroaniline | ||
|---|---|---|---|---|
| CAS Number | 527-20-8 | Molecular Weight | 265.352 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 335.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C6H2Cl5N | Melting Point | 232 °C | |
| MSDS | Chinese USA | Flash Point | 156.9±26.5 °C | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | Pentachloroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 335.8±37.0 °C at 760 mmHg |
| Melting Point | 232 °C |
| Molecular Formula | C6H2Cl5N |
| Molecular Weight | 265.352 |
| Flash Point | 156.9±26.5 °C |
| Exact Mass | 262.862976 |
| PSA | 26.02000 |
| LogP | 4.86 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | KHCZSJXTDDHLGJ-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| Storage condition | 0-6°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H373-H410 |
| Precautionary Statements | P261-P273-P280-P301 + P310-P311-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R23/24/25;R36/37/38 |
| Safety Phrases | S26-S36/37/39-S45-S22-S36/37 |
| RIDADR | 2811 |
| RTECS | BY7910000 |
| Hazard Class | 6.1 |
| HS Code | 2921420090 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Toxicokinetics of aromatic amines in guppy, Poecilia reticulata.
Sci. Total Environ. 109-110 , 383-6, (1991) In this study the elimination kinetics of several chlorinated anilines and a tetrachlorobenzene in guppy, Poecilia reticulata, have been determined. The elimination of all the chlorinated anilines in ... |
|
|
In vitro selection of DNA to chloroaromatics using magnetic microbead-based affinity separation and fluorescence detection.
Biochem. Biophys. Res. Commun. 234(1) , 117-20, (1997) In vitro selection (SELEX) of DNA ligands to the chloroaromatics, 4-chloroaniline (4-CA), 2,4,6-trichloroaniline (TCA) and pentachlorophenol (PCP), was performed by a novel method utilizing magnetic b... |
|
|
Enchytraeus crypticus as model species in soil ecotoxicology.
Chemosphere 87(11) , 1222-7, (2012) Enchytraeids are ecologically relevant soil organisms, due to their activity in decomposition and bioturbation in many soil types worldwide. The enchytraeid reproduction test (ERT) guidelines ISO 1638... |
| Benzenamine, 2,3,4,5,6-pentachloro- |
| Aniline,2,3,4,5,6-pentachloro |
| PENTACHLOROANILINE,100MG,NEAT |
| pentachoroaniline |
| 2,3,4,5,6-PENTACHLOROANILINE |
| 2,3,4,5,6-Pentachlorobenzeneamine |
| pentachlorobenzenamine |
| 2,3,4,5,6-pentachloro-anilin |
| Pentachloroaminobenzene |
| Pentachloroaniline |
| benzenamine,pentachloro |
| MFCD00014769 |
| EINECS 208-410-3 |
| 2,3,4,5,6-Pentachloro aniline |