2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde
2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde structure
|
Common Name | 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 29237-14-7 | Molecular Weight | 330.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H18O6 |
|---|---|
| Molecular Weight | 330.33200 |
| Exact Mass | 330.11000 |
| PSA | 71.06000 |
| LogP | 3.01300 |
| InChIKey | LCUJDGQKKNLFOJ-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)c(-c2cc(OC)c(OC)cc2C=O)cc1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
CAS#:19179-34-1
CAS#:68-12-2
CAS#:5392-10-9
CAS#:73252-55-8
CAS#:61599-78-8
CAS#:61203-53-0![Benzene,1,1'-[oxybis(methylene)]bis[3,4-dimethoxy- (9CI) Structure](https://image.chemsrc.com/caspic/426/23702-54-7.png)
CAS#:23702-54-7This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2'-diformyl-4,4',5,5'-tetramethoxybiphenyl |
| 4,4',5,5'-Tetramethoxy-2,2'-biphenyl-dicarboxaldehyd |
| 4,5,4',5'-Tetramethoxy-biphenyl-2,2'-dicarbaldehyd |
| bis-veratraldehyde |
| 4,5,4',5'-tetramethoxy-1,1'-biphenyl-2,2'-dicarboxaldehyde |
| 4,4',5,5'-Tetramethoxy-2,2'-bibenzaldehyd |
| 4,5,4',5'-tetramethoxy-biphenyl-2,2'-dicarbaldehyde |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde? |
| A: CAS number of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde is 29237-14-7. |
| Q: What are the upstream materials of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde? |
| A: Related upstream materials(CAS) of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde: 19179-34-1;68-12-2;5392-10-9;73252-55-8;61599-78-8;61203-53-0;23702-54-7. |
| Q: What is the SMILES notation of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde? |
| A: SMILES notation of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde is COc1cc(C=O)c(-c2cc(OC)c(OC)cc2C=O)cc1OC. |
| Q: What is the polar surface area (PSA) of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde? |
| A: Polar surface area (PSA) of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde is 71.06000. |
| Q: What English synonyms does 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde have? |
| A: English synonyms of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde: 2,2'-diformyl-4,4',5,5'-tetramethoxybiphenyl, 4,4',5,5'-Tetramethoxy-2,2'-biphenyl-dicarboxaldehyd, 4,5,4',5'-Tetramethoxy-biphenyl-2,2'-dicarbaldehyd, bis-veratraldehyde, 4,5,4',5'-tetramethoxy-1,1'-biphenyl-2,2'-dicarboxaldehyde, 4,4',5,5'-Tetramethoxy-2,2'-bibenzaldehyd, 4,5,4',5'-tetramethoxy-biphenyl-2,2'-dicarbaldehyde. |
| Q: What is the molecular weight of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde? |
| A: Molecular weight of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde is 330.33200. |
| Q: What is the Chinese name of 29237-14-7? |
| A: Chinese name of 29237-14-7 is 29237-14-7. |
| Q: What is the LogP of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde? |
| A: LogP of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde is 3.01300. |
| Q: What is the InChIKey of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde? |
| A: InChIKey of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde is LCUJDGQKKNLFOJ-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde? |
| A: The English name of 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde is 2-(2-formyl-4,5-dimethoxyphenyl)-4,5-dimethoxybenzaldehyde. |