USP1-IN-5 structure
|
Common Name | USP1-IN-5 | ||
|---|---|---|---|---|
| CAS Number | 2925547-94-8 | Molecular Weight | 532.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H23F3N8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of USP1-IN-5USP1-IN-5 (compound 10) is a USP1 inhibitor (IC50<50 nM). USP1-IN-5 also inhibits MDA-MB-436 cells with IC50 <50 nM[1]. |
| Name | USP1-IN-5 |
|---|
| Description | USP1-IN-5 (compound 10) is a USP1 inhibitor (IC50<50 nM). USP1-IN-5 also inhibits MDA-MB-436 cells with IC50 <50 nM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: <50 nM (USP1)[1] |
| References |
| Molecular Formula | C27H23F3N8O |
|---|---|
| Molecular Weight | 532.52 |
| InChIKey | BNEUCBYECWITRJ-UHFFFAOYSA-N |
| SMILES | COc1ncnc(C2CC2)c1-c1ncc2cnn(CC34C5C6C3C3C4C5C63c3nc(C(F)(F)F)cn3C)c2n1 |